C10H11F5N2O — CID 106290037
2-fluoro-5-methoxy-1-N-(2,2,3,3-tetrafluoropropyl)benzene-1,4-diamine (PubChem CID 106290037) has the molecular formula C10H11F5N2O and a molecular weight of 270.20 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-1-N-(2,2,3,3-tetrafluoropropyl)benzene-1,4-diamine.
| Compound Name | 2-fluoro-5-methoxy-1-N-(2,2,3,3-tetrafluoropropyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106290037 |
| Molecular Formula | C10H11F5N2O |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-fluoro-5-methoxy-1-N-(2,2,3,3-tetrafluoropropyl)benzene-1,4-diamine |
| SMILES | COc1cc(NCC(F)(F)C(F)F)c(F)cc1N |
| InChI | InChI=1S/C10H11F5N2O/c1-18-8-3-7(5(11)2-6(8)16)17-4-10(14,15)9(12)13/h2-3,9,17H,4,16H2,1H3 |
| InChIKey | RMIRSHGJPBESHY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|