C14H23FN2O2 — CID 107259384
1-(4-amino-2-fluoro-5-methoxyanilino)-2,4-dimethylpentan-2-ol (PubChem CID 107259384) has the molecular formula C14H23FN2O2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-(4-amino-2-fluoro-5-methoxyanilino)-2,4-dimethylpentan-2-ol.
| Compound Name | 1-(4-amino-2-fluoro-5-methoxyanilino)-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 107259384 |
| Molecular Formula | C14H23FN2O2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1-(4-amino-2-fluoro-5-methoxyanilino)-2,4-dimethylpentan-2-ol |
| SMILES | COc1cc(NCC(C)(O)CC(C)C)c(F)cc1N |
| InChI | InChI=1S/C14H23FN2O2/c1-9(2)7-14(3,18)8-17-12-6-13(19-4)11(16)5-10(12)15/h5-6,9,17-18H,7-8,16H2,1-4H3 |
| InChIKey | VOGRHJWEVRGWMZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|