C14H21FN2O2 — CID 106120262
4-[(4-amino-2-fluoro-5-methoxyanilino)methyl]cyclohexan-1-ol (PubChem CID 106120262) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 4-[(4-amino-2-fluoro-5-methoxyanilino)methyl]cyclohexan-1-ol.
| Compound Name | 4-[(4-amino-2-fluoro-5-methoxyanilino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106120262 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-[(4-amino-2-fluoro-5-methoxyanilino)methyl]cyclohexan-1-ol |
| SMILES | COc1cc(NCC2CCC(O)CC2)c(F)cc1N |
| InChI | InChI=1S/C14H21FN2O2/c1-19-14-7-13(11(15)6-12(14)16)17-8-9-2-4-10(18)5-3-9/h6-7,9-10,17-18H,2-5,8,16H2,1H3 |
| InChIKey | CMFWDKGJIDQQAE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|