C14H22FN3O — CID 107259506
1-N-(2,6-dimethylpiperidin-1-yl)-2-fluoro-5-methoxybenzene-1,4-diamine (PubChem CID 107259506) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-N-(2,6-dimethylpiperidin-1-yl)-2-fluoro-5-methoxybenzene-1,4-diamine.
| Compound Name | 1-N-(2,6-dimethylpiperidin-1-yl)-2-fluoro-5-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 107259506 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-N-(2,6-dimethylpiperidin-1-yl)-2-fluoro-5-methoxybenzene-1,4-diamine |
| SMILES | COc1cc(NN2C(C)CCCC2C)c(F)cc1N |
| InChI | InChI=1S/C14H22FN3O/c1-9-5-4-6-10(2)18(9)17-13-8-14(19-3)12(16)7-11(13)15/h7-10,17H,4-6,16H2,1-3H3 |
| InChIKey | IZWWSWRBQTWZIX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|