C13H20FN3O2 — CID 107259478
2-(4-amino-2-fluoro-5-methoxyanilino)-N-tert-butylacetamide (PubChem CID 107259478) has the molecular formula C13H20FN3O2 and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-(4-amino-2-fluoro-5-methoxyanilino)-N-tert-butylacetamide.
| Compound Name | 2-(4-amino-2-fluoro-5-methoxyanilino)-N-tert-butylacetamide |
|---|---|
| PubChem CID | 107259478 |
| Molecular Formula | C13H20FN3O2 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-(4-amino-2-fluoro-5-methoxyanilino)-N-tert-butylacetamide |
| SMILES | COc1cc(NCC(=O)NC(C)(C)C)c(F)cc1N |
| InChI | InChI=1S/C13H20FN3O2/c1-13(2,3)17-12(18)7-16-10-6-11(19-4)9(15)5-8(10)14/h5-6,16H,7,15H2,1-4H3,(H,17,18) |
| InChIKey | PVFVSGPAZDMGAV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|