C8H9Cl2NO — CID 82283226
2,5-dichloro-4-methoxy-N-methylaniline (PubChem CID 82283226) has the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. Its IUPAC name is 2,5-dichloro-4-methoxy-N-methylaniline.
| Compound Name | 2,5-dichloro-4-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 82283226 |
| Molecular Formula | C8H9Cl2NO |
| Molecular Weight | 206.07 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 2,5-dichloro-4-methoxy-N-methylaniline |
| SMILES | CNc1cc(Cl)c(OC)cc1Cl |
| InChI | InChI=1S/C8H9Cl2NO/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4,11H,1-2H3 |
| InChIKey | KGJQXXPOKWQXDW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.07 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|