C14H16ClNO3 — CID 115742755
5-chloro-2,4-dimethoxy-N-[(3-methylfuran-2-yl)methyl]aniline (PubChem CID 115742755) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is 5-chloro-2,4-dimethoxy-N-[(3-methylfuran-2-yl)methyl]aniline.
| Compound Name | 5-chloro-2,4-dimethoxy-N-[(3-methylfuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 115742755 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-chloro-2,4-dimethoxy-N-[(3-methylfuran-2-yl)methyl]aniline |
| SMILES | COc1cc(OC)c(NCc2occc2C)cc1Cl |
| InChI | InChI=1S/C14H16ClNO3/c1-9-4-5-19-14(9)8-16-11-6-10(15)12(17-2)7-13(11)18-3/h4-7,16H,8H2,1-3H3 |
| InChIKey | XBVYVBLZPOSBKQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|