C15H18ClNO3 — CID 62344876
5-chloro-N-[(5-ethylfuran-2-yl)methyl]-2,4-dimethoxyaniline (PubChem CID 62344876) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 5-chloro-N-[(5-ethylfuran-2-yl)methyl]-2,4-dimethoxyaniline.
| Compound Name | 5-chloro-N-[(5-ethylfuran-2-yl)methyl]-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 62344876 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-chloro-N-[(5-ethylfuran-2-yl)methyl]-2,4-dimethoxyaniline |
| SMILES | CCc1ccc(CNc2cc(Cl)c(OC)cc2OC)o1 |
| InChI | InChI=1S/C15H18ClNO3/c1-4-10-5-6-11(20-10)9-17-13-7-12(16)14(18-2)8-15(13)19-3/h5-8,17H,4,9H2,1-3H3 |
| InChIKey | ZDILGINIBNHTPZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|