C15H18ClNO3 — CID 97229543
(1R)-2-[[(1R)-1-(5-chloro-2-methoxyphenyl)ethyl]amino]-1-(furan-2-yl)ethanol (PubChem CID 97229543) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is (1R)-2-[[(1R)-1-(5-chloro-2-methoxyphenyl)ethyl]amino]-1-(furan-2-yl)ethanol.
| Compound Name | (1R)-2-[[(1R)-1-(5-chloro-2-methoxyphenyl)ethyl]amino]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 97229543 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (1R)-2-[[(1R)-1-(5-chloro-2-methoxyphenyl)ethyl]amino]-1-(furan-2-yl)ethanol |
| SMILES | COc1ccc(Cl)cc1[C@@H](C)NC[C@@H](O)c1ccco1 |
| InChI | InChI=1S/C15H18ClNO3/c1-10(12-8-11(16)5-6-14(12)19-2)17-9-13(18)15-4-3-7-20-15/h3-8,10,13,17-18H,9H2,1-2H3/t10-,13-/m1/s1 |
| InChIKey | XJBKWLHHHLCEHU-ZWNOBZJWSA-N |
| XLogP | 3.33 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |