C14H15FN2O4 — CID 78877901
1-(4-fluoro-2-methoxyphenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 78877901) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is 1-(4-fluoro-2-methoxyphenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-(4-fluoro-2-methoxyphenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 78877901 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(4-fluoro-2-methoxyphenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | COc1cc(F)ccc1NC(=O)NCC(O)c1ccco1 |
| InChI | InChI=1S/C14H15FN2O4/c1-20-13-7-9(15)4-5-10(13)17-14(19)16-8-11(18)12-3-2-6-21-12/h2-7,11,18H,8H2,1H3,(H2,16,17,19) |
| InChIKey | AIBWOCZJTRKGDI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |