C20H19FN2O4 — CID 86988466
1-[3-[(4-fluorophenyl)methoxy]phenyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 86988466) has the molecular formula C20H19FN2O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-[3-[(4-fluorophenyl)methoxy]phenyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-[3-[(4-fluorophenyl)methoxy]phenyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 86988466 |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-[3-[(4-fluorophenyl)methoxy]phenyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccco1)Nc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H19FN2O4/c21-15-8-6-14(7-9-15)13-27-17-4-1-3-16(11-17)23-20(25)22-12-18(24)19-5-2-10-26-19/h1-11,18,24H,12-13H2,(H2,22,23,25) |
| InChIKey | PDUAIRRHJPBNLM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |