C15H17FN2O4 — CID 87006078
1-(2-ethoxy-4-fluorophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 87006078) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is 1-(2-ethoxy-4-fluorophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-(2-ethoxy-4-fluorophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 87006078 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-(2-ethoxy-4-fluorophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | CCOc1cc(F)ccc1NC(=O)NCC(O)c1ccco1 |
| InChI | InChI=1S/C15H17FN2O4/c1-2-21-14-8-10(16)5-6-11(14)18-15(20)17-9-12(19)13-4-3-7-22-13/h3-8,12,19H,2,9H2,1H3,(H2,17,18,20) |
| InChIKey | MKMYKHUVQOAZKW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |