C13H12ClFN2O3 — CID 110890476
1-(2-chloro-4-fluorophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 110890476) has the molecular formula C13H12ClFN2O3 and a molecular weight of 298.70 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 110890476 |
| Molecular Formula | C13H12ClFN2O3 |
| Molecular Weight | 298.70 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccco1)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H12ClFN2O3/c14-9-6-8(15)3-4-10(9)17-13(19)16-7-11(18)12-2-1-5-20-12/h1-6,11,18H,7H2,(H2,16,17,19) |
| InChIKey | YLBZZPFXPVTSMS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |