C15H18O4S — CID 61099992
(5-methylthiophen-2-yl)-(2,3,4-trimethoxyphenyl)methanol (PubChem CID 61099992) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is (5-methylthiophen-2-yl)-(2,3,4-trimethoxyphenyl)methanol.
| Compound Name | (5-methylthiophen-2-yl)-(2,3,4-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 61099992 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (5-methylthiophen-2-yl)-(2,3,4-trimethoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2ccc(C)s2)c(OC)c1OC |
| InChI | InChI=1S/C15H18O4S/c1-9-5-8-12(20-9)13(16)10-6-7-11(17-2)15(19-4)14(10)18-3/h5-8,13,16H,1-4H3 |
| InChIKey | MRCBJLFWRIVBSG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |