C21H28O8 — CID 10597573
[6-(dimethoxymethyl)-2,3,4-trimethoxyphenyl]-(3,4-dimethoxyphenyl)methanol (PubChem CID 10597573) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is [6-(dimethoxymethyl)-2,3,4-trimethoxyphenyl]-(3,4-dimethoxyphenyl)methanol.
| Compound Name | [6-(dimethoxymethyl)-2,3,4-trimethoxyphenyl]-(3,4-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 10597573 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [6-(dimethoxymethyl)-2,3,4-trimethoxyphenyl]-(3,4-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2c(C(OC)OC)cc(OC)c(OC)c2OC)cc1OC |
| InChI | InChI=1S/C21H28O8/c1-23-14-9-8-12(10-15(14)24-2)18(22)17-13(21(28-6)29-7)11-16(25-3)19(26-4)20(17)27-5/h8-11,18,21-22H,1-7H3 |
| InChIKey | LCCGLZPPKSBKFS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|