C15H18O4 — CID 61100714
(3,4-dimethoxyphenyl)-(2,5-dimethylfuran-3-yl)methanol (PubChem CID 61100714) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(2,5-dimethylfuran-3-yl)methanol.
| Compound Name | (3,4-dimethoxyphenyl)-(2,5-dimethylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 61100714 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(2,5-dimethylfuran-3-yl)methanol |
| SMILES | COc1ccc(C(O)c2cc(C)oc2C)cc1OC |
| InChI | InChI=1S/C15H18O4/c1-9-7-12(10(2)19-9)15(16)11-5-6-13(17-3)14(8-11)18-4/h5-8,15-16H,1-4H3 |
| InChIKey | QVIWXFVDZMMKGJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |