C24H39ClO3S — CID 157100977
2-chloro-1-ethoxy-3-[4-[4-(2-methylbutan-2-ylsulfonylmethyl)cyclohexyl]butyl]benzene (PubChem CID 157100977) has the molecular formula C24H39ClO3S and a molecular weight of 443.09 g/mol. Its IUPAC name is 2-chloro-1-ethoxy-3-[4-[4-(2-methylbutan-2-ylsulfonylmethyl)cyclohexyl]butyl]benzene.
| Compound Name | 2-chloro-1-ethoxy-3-[4-[4-(2-methylbutan-2-ylsulfonylmethyl)cyclohexyl]butyl]benzene |
|---|---|
| PubChem CID | 157100977 |
| Molecular Formula | C24H39ClO3S |
| Molecular Weight | 443.09 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-chloro-1-ethoxy-3-[4-[4-(2-methylbutan-2-ylsulfonylmethyl)cyclohexyl]butyl]benzene |
| SMILES | CCOc1cccc(CCCCC2CCC(CS(=O)(=O)C(C)(C)CC)CC2)c1Cl |
| InChI | InChI=1S/C24H39ClO3S/c1-5-24(3,4)29(26,27)18-20-16-14-19(15-17-20)10-7-8-11-21-12-9-13-22(23(21)25)28-6-2/h9,12-13,19-20H,5-8,10-11,14-18H2,1-4H3 |
| InChIKey | GTCOYQNYELQKLC-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.09 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|