C24H35NO3S — CID 58145655
3-[6-[4-(tert-butylsulfonylmethyl)cyclohexyl]-6-oxohexyl]benzonitrile (PubChem CID 58145655) has the molecular formula C24H35NO3S and a molecular weight of 417.62 g/mol. Its IUPAC name is 3-[6-[4-(tert-butylsulfonylmethyl)cyclohexyl]-6-oxohexyl]benzonitrile.
| Compound Name | 3-[6-[4-(tert-butylsulfonylmethyl)cyclohexyl]-6-oxohexyl]benzonitrile |
|---|---|
| PubChem CID | 58145655 |
| Molecular Formula | C24H35NO3S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 3-[6-[4-(tert-butylsulfonylmethyl)cyclohexyl]-6-oxohexyl]benzonitrile |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCC(C(=O)CCCCCc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C24H35NO3S/c1-24(2,3)29(27,28)18-20-12-14-22(15-13-20)23(26)11-6-4-5-8-19-9-7-10-21(16-19)17-25/h7,9-10,16,20,22H,4-6,8,11-15,18H2,1-3H3 |
| InChIKey | ZKUZLRHANPUOJO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|