C25H41NO2S — CID 157456647
(3R,5R)-3,5-dimethyl-1-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]piperidine (PubChem CID 157456647) has the molecular formula C25H41NO2S and a molecular weight of 419.68 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethyl-1-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]piperidine.
| Compound Name | (3R,5R)-3,5-dimethyl-1-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]piperidine |
|---|---|
| PubChem CID | 157456647 |
| Molecular Formula | C25H41NO2S |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | (3R,5R)-3,5-dimethyl-1-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]piperidine |
| SMILES | CC(C)S(=O)(=O)CC1CCC(CCc2ccc(N3C[C@H](C)C[C@@H](C)C3)cc2)CC1 |
| InChI | InChI=1S/C25H41NO2S/c1-19(2)29(27,28)18-24-9-7-22(8-10-24)5-6-23-11-13-25(14-12-23)26-16-20(3)15-21(4)17-26/h11-14,19-22,24H,5-10,15-18H2,1-4H3/t20-,21-,22?,24?/m1/s1 |
| InChIKey | WAEYCWGUNKJYSF-NJRHGXBZSA-N |
| XLogP | 5.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|