C26H38N4O2S — CID 158496312
2-[4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]piperazin-1-yl]pyrimidine (PubChem CID 158496312) has the molecular formula C26H38N4O2S and a molecular weight of 470.68 g/mol. Its IUPAC name is 2-[4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 158496312 |
| Molecular Formula | C26H38N4O2S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 2-[4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]piperazin-1-yl]pyrimidine |
| SMILES | CC(C)S(=O)(=O)CC1CCC(CCc2ccc(N3CCN(c4ncccn4)CC3)cc2)CC1 |
| InChI | InChI=1S/C26H38N4O2S/c1-21(2)33(31,32)20-24-8-6-22(7-9-24)4-5-23-10-12-25(13-11-23)29-16-18-30(19-17-29)26-27-14-3-15-28-26/h3,10-15,21-22,24H,4-9,16-20H2,1-2H3 |
| InChIKey | WCMDUXAZYJVNAF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|