C25H41NO3S — CID 159107608
(2S,6R)-2,6-dimethyl-4-[3-methyl-4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine (PubChem CID 159107608) has the molecular formula C25H41NO3S and a molecular weight of 435.67 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-[3-methyl-4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine.
| Compound Name | (2S,6R)-2,6-dimethyl-4-[3-methyl-4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine |
|---|---|
| PubChem CID | 159107608 |
| Molecular Formula | C25H41NO3S |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-[3-methyl-4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine |
| SMILES | Cc1cc(N2C[C@@H](C)O[C@@H](C)C2)ccc1CCC1CCC(CS(=O)(=O)C(C)C)CC1 |
| InChI | InChI=1S/C25H41NO3S/c1-18(2)30(27,28)17-23-8-6-22(7-9-23)10-11-24-12-13-25(14-19(24)3)26-15-20(4)29-21(5)16-26/h12-14,18,20-23H,6-11,15-17H2,1-5H3/t20-,21+,22?,23? |
| InChIKey | CQAAPKPZRRXVGO-OIRDZHBESA-N |
| XLogP | 5.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|