C24H39NO3S — CID 158176073
(2S,6R)-2,6-dimethyl-4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine (PubChem CID 158176073) has the molecular formula C24H39NO3S and a molecular weight of 421.65 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine.
| Compound Name | (2S,6R)-2,6-dimethyl-4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine |
|---|---|
| PubChem CID | 158176073 |
| Molecular Formula | C24H39NO3S |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine |
| SMILES | CC(C)S(=O)(=O)CC1CCC(CCc2ccc(N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 |
| InChI | InChI=1S/C24H39NO3S/c1-18(2)29(26,27)17-23-9-7-21(8-10-23)5-6-22-11-13-24(14-12-22)25-15-19(3)28-20(4)16-25/h11-14,18-21,23H,5-10,15-17H2,1-4H3/t19-,20+,21?,23? |
| InChIKey | LKMZQTALGFEGQL-CVFDLSLPSA-N |
| XLogP | 4.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|