C24H41NO3S — CID 59546175
(2S,6R)-4-[4-(7-tert-butylsulfonylheptyl)-2-methylphenyl]-2,6-dimethylmorpholine (PubChem CID 59546175) has the molecular formula C24H41NO3S and a molecular weight of 423.66 g/mol. Its IUPAC name is (2S,6R)-4-[4-(7-tert-butylsulfonylheptyl)-2-methylphenyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[4-(7-tert-butylsulfonylheptyl)-2-methylphenyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 59546175 |
| Molecular Formula | C24H41NO3S |
| Molecular Weight | 423.66 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | (2S,6R)-4-[4-(7-tert-butylsulfonylheptyl)-2-methylphenyl]-2,6-dimethylmorpholine |
| SMILES | Cc1cc(CCCCCCCS(=O)(=O)C(C)(C)C)ccc1N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C24H41NO3S/c1-19-16-22(13-14-23(19)25-17-20(2)28-21(3)18-25)12-10-8-7-9-11-15-29(26,27)24(4,5)6/h13-14,16,20-21H,7-12,15,17-18H2,1-6H3/t20-,21+ |
| InChIKey | ABMGYQZAJZXKFF-OYRHEFFESA-N |
| XLogP | 5.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|