C17H27NO — CID 129268317
(2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine (PubChem CID 129268317) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 129268317 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine |
| SMILES | Cc1cc(C(C)(C)C)ccc1N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C17H27NO/c1-12-9-15(17(4,5)6)7-8-16(12)18-10-13(2)19-14(3)11-18/h7-9,13-14H,10-11H2,1-6H3/t13-,14+ |
| InChIKey | CRDJJAIVMZWNMZ-OKILXGFUSA-N |
| XLogP | 3.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |