About (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine
(2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine (PubChem CID 129268317) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine |
| PubChem CID | 129268317 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine |
| SMILES | Cc1cc(C(C)(C)C)ccc1N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C17H27NO/c1-12-9-15(17(4,5)6)7-8-16(12)18-10-13(2)19-14(3)11-18/h7-9,13-14H,10-11H2,1-6H3/t13-,14+ |
| InChIKey | CRDJJAIVMZWNMZ-OKILXGFUSA-N |
| XLogP | 3.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine?
The IUPAC name of (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine (CID 129268317) is (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine.
What is the SMILES notation for (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine?
The canonical SMILES for (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine is Cc1cc(C(C)(C)C)ccc1N1C[C@@H](C)O[C@@H](C)C1.
What is the InChIKey of (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine?
The InChIKey is CRDJJAIVMZWNMZ-OKILXGFUSA-N. The full InChI is InChI=1S/C17H27NO/c1-12-9-15(17(4,5)6)7-8-16(12)18-10-13(2)19-14(3)11-18/h7-9,13-14H,10-11H2,1-6H3/t13-,14+.
What are the key properties of (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine?
(2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine has a molecular weight of 261.41 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-4-(4-tert-butyl-2-methylphenyl)-2,6-dimethylmorpholine is sourced from PubChem (CID 129268317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).