C14H16F3NO2 — CID 18455608
2-(2,6-dimethylmorpholin-4-yl)-5-(trifluoromethyl)benzaldehyde (PubChem CID 18455608) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-5-(trifluoromethyl)benzaldehyde.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-5-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 18455608 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-5-(trifluoromethyl)benzaldehyde |
| SMILES | CC1CN(c2ccc(C(F)(F)F)cc2C=O)CC(C)O1 |
| InChI | InChI=1S/C14H16F3NO2/c1-9-6-18(7-10(2)20-9)13-4-3-12(14(15,16)17)5-11(13)8-19/h3-5,8-10H,6-7H2,1-2H3 |
| InChIKey | LTWBZIRURAREAC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|