C13H17F3N2O — CID 124634394
3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(trifluoromethyl)aniline (PubChem CID 124634394) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(trifluoromethyl)aniline.
| Compound Name | 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 124634394 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(trifluoromethyl)aniline |
| SMILES | C[C@@H]1CN(c2cc(N)cc(C(F)(F)F)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C13H17F3N2O/c1-8-6-18(7-9(2)19-8)12-4-10(13(14,15)16)3-11(17)5-12/h3-5,8-9H,6-7,17H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | XWUWAIZAGVBMJP-RKDXNWHRSA-N |
| XLogP | 2.90 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|