C12H15F3N2O — CID 118231317
3-(2,5-dimethyl-1,3-oxazolidin-3-yl)-5-(trifluoromethyl)aniline (PubChem CID 118231317) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 3-(2,5-dimethyl-1,3-oxazolidin-3-yl)-5-(trifluoromethyl)aniline.
| Compound Name | 3-(2,5-dimethyl-1,3-oxazolidin-3-yl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 118231317 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-(2,5-dimethyl-1,3-oxazolidin-3-yl)-5-(trifluoromethyl)aniline |
| SMILES | CC1CN(c2cc(N)cc(C(F)(F)F)c2)C(C)O1 |
| InChI | InChI=1S/C12H15F3N2O/c1-7-6-17(8(2)18-7)11-4-9(12(13,14)15)3-10(16)5-11/h3-5,7-8H,6,16H2,1-2H3 |
| InChIKey | QRYAWBACKZIAPY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|