C13H12F6O — CID 102340222
(2R,5R)-2-[3,5-bis(trifluoromethyl)phenyl]-5-methyloxolane (PubChem CID 102340222) has the molecular formula C13H12F6O and a molecular weight of 298.23 g/mol. Its IUPAC name is (2R,5R)-2-[3,5-bis(trifluoromethyl)phenyl]-5-methyloxolane.
| Compound Name | (2R,5R)-2-[3,5-bis(trifluoromethyl)phenyl]-5-methyloxolane |
|---|---|
| PubChem CID | 102340222 |
| Molecular Formula | C13H12F6O |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (2R,5R)-2-[3,5-bis(trifluoromethyl)phenyl]-5-methyloxolane |
| SMILES | C[C@@H]1CC[C@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C13H12F6O/c1-7-2-3-11(20-7)8-4-9(12(14,15)16)6-10(5-8)13(17,18)19/h4-7,11H,2-3H2,1H3/t7-,11-/m1/s1 |
| InChIKey | NGJYGUAEEZKIRI-RDDDGLTNSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |