About 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine
6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine (PubChem CID 115351325) has the molecular formula C13H15F4NO
and a molecular weight of 277.26 g/mol. Its IUPAC name is 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine.
Molecular Properties
| Compound Name | 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine |
| PubChem CID | 115351325 |
| Molecular Formula | C13H15F4NO |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine |
| SMILES | CC1NCC(c2cc(F)cc(C(F)(F)F)c2)OC1C |
| InChI | InChI=1S/C13H15F4NO/c1-7-8(2)19-12(6-18-7)9-3-10(13(15,16)17)5-11(14)4-9/h3-5,7-8,12,18H,6H2,1-2H3 |
| InChIKey | KAKPXUJBOBFNHJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine?
The IUPAC name of 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine (CID 115351325) is 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine.
What is the SMILES notation for 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine?
The canonical SMILES for 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine is CC1NCC(c2cc(F)cc(C(F)(F)F)c2)OC1C.
What is the InChIKey of 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine?
The InChIKey is KAKPXUJBOBFNHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F4NO/c1-7-8(2)19-12(6-18-7)9-3-10(13(15,16)17)5-11(14)4-9/h3-5,7-8,12,18H,6H2,1-2H3.
What are the key properties of 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine?
6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine has a molecular weight of 277.26 g/mol, XLogP of 3.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3-dimethylmorpholine is sourced from PubChem (CID 115351325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).