C12H13F4N — CID 115351224
3-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methylpyrrolidine (PubChem CID 115351224) has the molecular formula C12H13F4N and a molecular weight of 247.23 g/mol. Its IUPAC name is 3-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methylpyrrolidine.
| Compound Name | 3-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methylpyrrolidine |
|---|---|
| PubChem CID | 115351224 |
| Molecular Formula | C12H13F4N |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methylpyrrolidine |
| SMILES | CC1NCCC1c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F4N/c1-7-11(2-3-17-7)8-4-9(12(14,15)16)6-10(13)5-8/h4-7,11,17H,2-3H2,1H3 |
| InChIKey | JYIXOHRSYZMBHO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |