C13H14F6N2 — CID 72985887
1-[3,5-bis(trifluoromethyl)phenyl]-2-methylpiperazine (PubChem CID 72985887) has the molecular formula C13H14F6N2 and a molecular weight of 312.26 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-2-methylpiperazine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 72985887 |
| Molecular Formula | C13H14F6N2 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-methylpiperazine |
| SMILES | CC1CNCCN1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F6N2/c1-8-7-20-2-3-21(8)11-5-9(12(14,15)16)4-10(6-11)13(17,18)19/h4-6,8,20H,2-3,7H2,1H3 |
| InChIKey | XXZBOXNQPMRDHE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |