C14H15F3N2O — CID 23402450
(2S)-2-methyl-1-[5-(trifluoromethyl)-1-benzofuran-7-yl]piperazine (PubChem CID 23402450) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is (2S)-2-methyl-1-[5-(trifluoromethyl)-1-benzofuran-7-yl]piperazine.
| Compound Name | (2S)-2-methyl-1-[5-(trifluoromethyl)-1-benzofuran-7-yl]piperazine |
|---|---|
| PubChem CID | 23402450 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (2S)-2-methyl-1-[5-(trifluoromethyl)-1-benzofuran-7-yl]piperazine |
| SMILES | C[C@H]1CNCCN1c1cc(C(F)(F)F)cc2ccoc12 |
| InChI | InChI=1S/C14H15F3N2O/c1-9-8-18-3-4-19(9)12-7-11(14(15,16)17)6-10-2-5-20-13(10)12/h2,5-7,9,18H,3-4,8H2,1H3/t9-/m0/s1 |
| InChIKey | WYSWKELDPCCJJT-VIFPVBQESA-N |
| XLogP | 3.25 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |