C15H16F3NO — CID 22495560
3-methyl-4-[5-(trifluoromethyl)-1-benzofuran-7-yl]piperidine (PubChem CID 22495560) has the molecular formula C15H16F3NO and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-methyl-4-[5-(trifluoromethyl)-1-benzofuran-7-yl]piperidine.
| Compound Name | 3-methyl-4-[5-(trifluoromethyl)-1-benzofuran-7-yl]piperidine |
|---|---|
| PubChem CID | 22495560 |
| Molecular Formula | C15H16F3NO |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-methyl-4-[5-(trifluoromethyl)-1-benzofuran-7-yl]piperidine |
| SMILES | CC1CNCCC1c1cc(C(F)(F)F)cc2ccoc12 |
| InChI | InChI=1S/C15H16F3NO/c1-9-8-19-4-2-12(9)13-7-11(15(16,17)18)6-10-3-5-20-14(10)13/h3,5-7,9,12,19H,2,4,8H2,1H3 |
| InChIKey | XZWXSCAAZPWBAX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |