C15H20ClNO — CID 22495693
3-methyl-4-(2-methyl-1-benzofuran-7-yl)piperidine;hydrochloride (PubChem CID 22495693) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is 3-methyl-4-(2-methyl-1-benzofuran-7-yl)piperidine;hydrochloride.
| Compound Name | 3-methyl-4-(2-methyl-1-benzofuran-7-yl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 22495693 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-methyl-4-(2-methyl-1-benzofuran-7-yl)piperidine;hydrochloride |
| SMILES | Cc1cc2cccc(C3CCNCC3C)c2o1.Cl |
| InChI | InChI=1S/C15H19NO.ClH/c1-10-9-16-7-6-13(10)14-5-3-4-12-8-11(2)17-15(12)14;/h3-5,8,10,13,16H,6-7,9H2,1-2H3;1H |
| InChIKey | PHKYUDHGTPHWDY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |