C13H19Cl2N — CID 69230632
4-(4-chloro-2-methylphenyl)-3-methylpiperidine;hydrochloride (PubChem CID 69230632) has the molecular formula C13H19Cl2N and a molecular weight of 260.21 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenyl)-3-methylpiperidine;hydrochloride.
| Compound Name | 4-(4-chloro-2-methylphenyl)-3-methylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 69230632 |
| Molecular Formula | C13H19Cl2N |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-(4-chloro-2-methylphenyl)-3-methylpiperidine;hydrochloride |
| SMILES | Cc1cc(Cl)ccc1C1CCNCC1C.Cl |
| InChI | InChI=1S/C13H18ClN.ClH/c1-9-7-11(14)3-4-12(9)13-5-6-15-8-10(13)2;/h3-4,7,10,13,15H,5-6,8H2,1-2H3;1H |
| InChIKey | YTPSYXPBBAXFON-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |