C13H15ClF3N — CID 69230877
(3S,4S)-4-[2-chloro-4-(trifluoromethyl)phenyl]-3-methylpiperidine (PubChem CID 69230877) has the molecular formula C13H15ClF3N and a molecular weight of 277.72 g/mol. Its IUPAC name is (3S,4S)-4-[2-chloro-4-(trifluoromethyl)phenyl]-3-methylpiperidine.
| Compound Name | (3S,4S)-4-[2-chloro-4-(trifluoromethyl)phenyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 69230877 |
| Molecular Formula | C13H15ClF3N |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (3S,4S)-4-[2-chloro-4-(trifluoromethyl)phenyl]-3-methylpiperidine |
| SMILES | C[C@@H]1CNCC[C@@H]1c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H15ClF3N/c1-8-7-18-5-4-10(8)11-3-2-9(6-12(11)14)13(15,16)17/h2-3,6,8,10,18H,4-5,7H2,1H3/t8-,10+/m1/s1 |
| InChIKey | XNSNKZSJFGEBBL-SCZZXKLOSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |