About (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride
(3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride (PubChem CID 20775596) has the molecular formula C15H17ClF3NO
and a molecular weight of 319.75 g/mol. Its IUPAC name is (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride.
Molecular Properties
| Compound Name | (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride |
| PubChem CID | 20775596 |
| Molecular Formula | C15H17ClF3NO |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride |
| SMILES | C[C@H]1CNCC[C@H]1c1ccc(C(F)(F)F)c2ccoc12.Cl |
| InChI | InChI=1S/C15H16F3NO.ClH/c1-9-8-19-6-4-10(9)11-2-3-13(15(16,17)18)12-5-7-20-14(11)12;/h2-3,5,7,9-10,19H,4,6,8H2,1H3;1H/t9-,10+;/m0./s1 |
| InChIKey | VMQJDQHSNLRKQY-BAUSSPIASA-N |
| XLogP | 4.59 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride?
The IUPAC name of (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride (CID 20775596) is (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride.
What is the SMILES notation for (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride?
The canonical SMILES for (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride is C[C@H]1CNCC[C@H]1c1ccc(C(F)(F)F)c2ccoc12.Cl.
What is the InChIKey of (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride?
The InChIKey is VMQJDQHSNLRKQY-BAUSSPIASA-N. The full InChI is InChI=1S/C15H16F3NO.ClH/c1-9-8-19-6-4-10(9)11-2-3-13(15(16,17)18)12-5-7-20-14(11)12;/h2-3,5,7,9-10,19H,4,6,8H2,1H3;1H/t9-,10+;/m0./s1.
What are the key properties of (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride?
(3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride has a molecular weight of 319.75 g/mol, XLogP of 4.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3-methyl-4-[4-(trifluoromethyl)-1-benzofuran-7-yl]piperidine;hydrochloride is sourced from PubChem (CID 20775596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).