C20H32O2S — CID 59545922
5-(7-propan-2-ylsulfonylheptyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 59545922) has the molecular formula C20H32O2S and a molecular weight of 336.54 g/mol. Its IUPAC name is 5-(7-propan-2-ylsulfonylheptyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(7-propan-2-ylsulfonylheptyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 59545922 |
| Molecular Formula | C20H32O2S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 5-(7-propan-2-ylsulfonylheptyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)S(=O)(=O)CCCCCCCc1cccc2c1CCCC2 |
| InChI | InChI=1S/C20H32O2S/c1-17(2)23(21,22)16-9-5-3-4-6-11-18-13-10-14-19-12-7-8-15-20(18)19/h10,13-14,17H,3-9,11-12,15-16H2,1-2H3 |
| InChIKey | XOVMQSKMIAOXBQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|