C16H26N2O2S2 — CID 59545539
3-(7-propan-2-ylsulfonylheptyl)-2-thionitrosoaniline (PubChem CID 59545539) has the molecular formula C16H26N2O2S2 and a molecular weight of 342.53 g/mol. Its IUPAC name is 3-(7-propan-2-ylsulfonylheptyl)-2-thionitrosoaniline.
| Compound Name | 3-(7-propan-2-ylsulfonylheptyl)-2-thionitrosoaniline |
|---|---|
| PubChem CID | 59545539 |
| Molecular Formula | C16H26N2O2S2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-(7-propan-2-ylsulfonylheptyl)-2-thionitrosoaniline |
| SMILES | CC(C)S(=O)(=O)CCCCCCCc1cccc(N)c1N=S |
| InChI | InChI=1S/C16H26N2O2S2/c1-13(2)22(19,20)12-7-5-3-4-6-9-14-10-8-11-15(17)16(14)18-21/h8,10-11,13H,3-7,9,12,17H2,1-2H3 |
| InChIKey | TZMJAPBKYIXABI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|