C24H38O3S — CID 160600744
1-cyclohexyl-2-[3-(7-propan-2-ylsulfonylheptyl)phenyl]ethanone (PubChem CID 160600744) has the molecular formula C24H38O3S and a molecular weight of 406.63 g/mol. Its IUPAC name is 1-cyclohexyl-2-[3-(7-propan-2-ylsulfonylheptyl)phenyl]ethanone.
| Compound Name | 1-cyclohexyl-2-[3-(7-propan-2-ylsulfonylheptyl)phenyl]ethanone |
|---|---|
| PubChem CID | 160600744 |
| Molecular Formula | C24H38O3S |
| Molecular Weight | 406.63 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1-cyclohexyl-2-[3-(7-propan-2-ylsulfonylheptyl)phenyl]ethanone |
| SMILES | CC(C)S(=O)(=O)CCCCCCCc1cccc(CC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C24H38O3S/c1-20(2)28(26,27)17-10-5-3-4-7-12-21-13-11-14-22(18-21)19-24(25)23-15-8-6-9-16-23/h11,13-14,18,20,23H,3-10,12,15-17,19H2,1-2H3 |
| InChIKey | IPSDVXQRZXAVFI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|