C21H34O6S — CID 58144175
8-tert-butylsulfonyl-1-(3,4,5-trimethoxyphenyl)octan-3-one (PubChem CID 58144175) has the molecular formula C21H34O6S and a molecular weight of 414.56 g/mol. Its IUPAC name is 8-tert-butylsulfonyl-1-(3,4,5-trimethoxyphenyl)octan-3-one.
| Compound Name | 8-tert-butylsulfonyl-1-(3,4,5-trimethoxyphenyl)octan-3-one |
|---|---|
| PubChem CID | 58144175 |
| Molecular Formula | C21H34O6S |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 8-tert-butylsulfonyl-1-(3,4,5-trimethoxyphenyl)octan-3-one |
| SMILES | COc1cc(CCC(=O)CCCCCS(=O)(=O)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C21H34O6S/c1-21(2,3)28(23,24)13-9-7-8-10-17(22)12-11-16-14-18(25-4)20(27-6)19(15-16)26-5/h14-15H,7-13H2,1-6H3 |
| InChIKey | NNXNZWFZNADACC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|