C28H38ClNO4S — CID 58144917
7-tert-butylsulfonyl-1-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]heptan-2-one (PubChem CID 58144917) has the molecular formula C28H38ClNO4S and a molecular weight of 520.14 g/mol. Its IUPAC name is 7-tert-butylsulfonyl-1-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]heptan-2-one.
| Compound Name | 7-tert-butylsulfonyl-1-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]heptan-2-one |
|---|---|
| PubChem CID | 58144917 |
| Molecular Formula | C28H38ClNO4S |
| Molecular Weight | 520.14 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 7-tert-butylsulfonyl-1-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]heptan-2-one |
| SMILES | CC(C)(C)S(=O)(=O)CCCCCC(=O)Cc1ccc(N2CCC(O)(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H38ClNO4S/c1-27(2,3)35(33,34)20-6-4-5-7-26(31)21-22-8-14-25(15-9-22)30-18-16-28(32,17-19-30)23-10-12-24(29)13-11-23/h8-15,32H,4-7,16-21H2,1-3H3 |
| InChIKey | XOQSNNWYRADETB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.14 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|