C22H33NO4S — CID 58144500
N-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxoethyl]phenyl]-N-methylacetamide (PubChem CID 58144500) has the molecular formula C22H33NO4S and a molecular weight of 407.58 g/mol. Its IUPAC name is N-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxoethyl]phenyl]-N-methylacetamide.
| Compound Name | N-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxoethyl]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 58144500 |
| Molecular Formula | C22H33NO4S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxoethyl]phenyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1ccc(CC(=O)C2CCC(CS(=O)(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C22H33NO4S/c1-16(24)23(5)20-12-8-17(9-13-20)14-21(25)19-10-6-18(7-11-19)15-28(26,27)22(2,3)4/h8-9,12-13,18-19H,6-7,10-11,14-15H2,1-5H3 |
| InChIKey | ZAYIVJNBQGIRIF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |