C24H37NO3S — CID 58145673
1-[4-(2-methylbutan-2-ylsulfonylmethyl)cyclohexyl]-2-(4-pyrrolidin-1-ylphenyl)ethanone (PubChem CID 58145673) has the molecular formula C24H37NO3S and a molecular weight of 419.63 g/mol. Its IUPAC name is 1-[4-(2-methylbutan-2-ylsulfonylmethyl)cyclohexyl]-2-(4-pyrrolidin-1-ylphenyl)ethanone.
| Compound Name | 1-[4-(2-methylbutan-2-ylsulfonylmethyl)cyclohexyl]-2-(4-pyrrolidin-1-ylphenyl)ethanone |
|---|---|
| PubChem CID | 58145673 |
| Molecular Formula | C24H37NO3S |
| Molecular Weight | 419.63 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 1-[4-(2-methylbutan-2-ylsulfonylmethyl)cyclohexyl]-2-(4-pyrrolidin-1-ylphenyl)ethanone |
| SMILES | CCC(C)(C)S(=O)(=O)CC1CCC(C(=O)Cc2ccc(N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C24H37NO3S/c1-4-24(2,3)29(27,28)18-20-7-11-21(12-8-20)23(26)17-19-9-13-22(14-10-19)25-15-5-6-16-25/h9-10,13-14,20-21H,4-8,11-12,15-18H2,1-3H3 |
| InChIKey | OQMQBXLZYFMYOI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|