C24H36O4S — CID 58144218
1-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-(4-cyclopentyloxyphenyl)ethanone (PubChem CID 58144218) has the molecular formula C24H36O4S and a molecular weight of 420.62 g/mol. Its IUPAC name is 1-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-(4-cyclopentyloxyphenyl)ethanone.
| Compound Name | 1-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-(4-cyclopentyloxyphenyl)ethanone |
|---|---|
| PubChem CID | 58144218 |
| Molecular Formula | C24H36O4S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-(4-cyclopentyloxyphenyl)ethanone |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCC(C(=O)Cc2ccc(OC3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C24H36O4S/c1-24(2,3)29(26,27)17-19-8-12-20(13-9-19)23(25)16-18-10-14-22(15-11-18)28-21-6-4-5-7-21/h10-11,14-15,19-21H,4-9,12-13,16-17H2,1-3H3 |
| InChIKey | PTDMPJNSSLCEPE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |