About 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone
2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone (PubChem CID 58144646) has the molecular formula C22H31NO4S
and a molecular weight of 405.56 g/mol. Its IUPAC name is 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone.
Molecular Properties
| Compound Name | 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone |
| PubChem CID | 58144646 |
| Molecular Formula | C22H31NO4S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone |
| SMILES | O=C(Cc1ccc(OC2CCCC2)cc1)C1CCC(N2CCCS2(=O)=O)CC1 |
| InChI | InChI=1S/C22H31NO4S/c24-22(16-17-6-12-21(13-7-17)27-20-4-1-2-5-20)18-8-10-19(11-9-18)23-14-3-15-28(23,25)26/h6-7,12-13,18-20H,1-5,8-11,14-16H2 |
| InChIKey | UFASOWMVTGVFCP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone?
The IUPAC name of 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone (CID 58144646) is 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone.
What is the SMILES notation for 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone?
The canonical SMILES for 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone is O=C(Cc1ccc(OC2CCCC2)cc1)C1CCC(N2CCCS2(=O)=O)CC1.
What is the InChIKey of 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone?
The InChIKey is UFASOWMVTGVFCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO4S/c24-22(16-17-6-12-21(13-7-17)27-20-4-1-2-5-20)18-8-10-19(11-9-18)23-14-3-15-28(23,25)26/h6-7,12-13,18-20H,1-5,8-11,14-16H2.
What are the key properties of 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone?
2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone has a molecular weight of 405.56 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclopentyloxyphenyl)-1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]ethanone is sourced from PubChem (CID 58144646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).