C9H17N3O3S — CID 146082093
4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidine-1-carboxamide (PubChem CID 146082093) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidine-1-carboxamide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 146082093 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(N2CCCS2(=O)=O)CC1 |
| InChI | InChI=1S/C9H17N3O3S/c10-9(13)11-5-2-8(3-6-11)12-4-1-7-16(12,14)15/h8H,1-7H2,(H2,10,13) |
| InChIKey | OXDHPQZHOIDMKM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |