[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid

C10H18N2O4S — CID 139369242

IUPAC[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid
SMILESO=C(O)NC1CCC(N2CCCS2(=O)=O)CC1
InChIInChI=1S/C10H18N2O4S/c13-10(14)11-8-2-4-9(5-3-8)12-6-1-7-17(12,15)16/h8-9,11H,1-7H2,(H,13,14)
InChIKeyADRPNMIRHIVGIY-UHFFFAOYSA-N
MW262.33 g/mol
LogP0.60
Rot. Bonds2

About [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid

[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid (PubChem CID 139369242) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid.

Molecular Properties

Compound Name[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid
PubChem CID139369242
Molecular FormulaC10H18N2O4S
Molecular Weight262.33 g/mol
Exact Mass262.10
IUPAC Name[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid
SMILESO=C(O)NC1CCC(N2CCCS2(=O)=O)CC1
InChIInChI=1S/C10H18N2O4S/c13-10(14)11-8-2-4-9(5-3-8)12-6-1-7-17(12,15)16/h8-9,11H,1-7H2,(H,13,14)
InChIKeyADRPNMIRHIVGIY-UHFFFAOYSA-N
XLogP0.60
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.33
LogP ≤ 50.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid?
The IUPAC name of [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid (CID 139369242) is [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid.
What is the SMILES notation for [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid?
The canonical SMILES for [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid is O=C(O)NC1CCC(N2CCCS2(=O)=O)CC1.
What is the InChIKey of [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid?
The InChIKey is ADRPNMIRHIVGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4S/c13-10(14)11-8-2-4-9(5-3-8)12-6-1-7-17(12,15)16/h8-9,11H,1-7H2,(H,13,14).
What are the key properties of [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid?
[4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid has a molecular weight of 262.33 g/mol, XLogP of 0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexyl]carbamic acid is sourced from PubChem (CID 139369242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).