C23H35NO4S — CID 58145256
2-(4-cyclohexyloxyphenyl)-1-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethanone (PubChem CID 58145256) has the molecular formula C23H35NO4S and a molecular weight of 421.60 g/mol. Its IUPAC name is 2-(4-cyclohexyloxyphenyl)-1-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-cyclohexyloxyphenyl)-1-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 58145256 |
| Molecular Formula | C23H35NO4S |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-(4-cyclohexyloxyphenyl)-1-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethanone |
| SMILES | CC(C)S(=O)(=O)CC1CCN(C(=O)Cc2ccc(OC3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C23H35NO4S/c1-18(2)29(26,27)17-20-12-14-24(15-13-20)23(25)16-19-8-10-22(11-9-19)28-21-6-4-3-5-7-21/h8-11,18,20-21H,3-7,12-17H2,1-2H3 |
| InChIKey | NGQLWWSQUMXISH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |