C20H31NO3S — CID 58145380
2-(4-propan-2-ylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethanone (PubChem CID 58145380) has the molecular formula C20H31NO3S and a molecular weight of 365.54 g/mol. Its IUPAC name is 2-(4-propan-2-ylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-propan-2-ylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 58145380 |
| Molecular Formula | C20H31NO3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-(4-propan-2-ylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)piperidin-1-yl]ethanone |
| SMILES | CC(C)c1ccc(CC(=O)N2CCC(CS(=O)(=O)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H31NO3S/c1-15(2)19-7-5-17(6-8-19)13-20(22)21-11-9-18(10-12-21)14-25(23,24)16(3)4/h5-8,15-16,18H,9-14H2,1-4H3 |
| InChIKey | YSUPFZPJTDNMAB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |